C10H13N2O2S- — CID 18542490
2-(4,5-dimethyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 18542490) has the molecular formula C10H13N2O2S- and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | 2-(4,5-dimethyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18542490 |
| Molecular Formula | C10H13N2O2S- |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-(4,5-dimethyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | Cc1nc(C2CCCN2C(=O)[O-])sc1C |
| InChI | InChI=1S/C10H14N2O2S/c1-6-7(2)15-9(11-6)8-4-3-5-12(8)10(13)14/h8H,3-5H2,1-2H3,(H,13,14)/p-1 |
| InChIKey | IOWZPLTVNDHHHN-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |