C37H51F5O4S — CID 18544012
methyl 9,9,10,10,10-pentafluoro-2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]decanoate (PubChem CID 18544012) has the molecular formula C37H51F5O4S and a molecular weight of 686.87 g/mol. Its IUPAC name is methyl 9,9,10,10,10-pentafluoro-2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]decanoate.
| Compound Name | methyl 9,9,10,10,10-pentafluoro-2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]decanoate |
|---|---|
| PubChem CID | 18544012 |
| Molecular Formula | C37H51F5O4S |
| Molecular Weight | 686.87 g/mol |
| Exact Mass | 686.34 |
| IUPAC Name | methyl 9,9,10,10,10-pentafluoro-2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]decanoate |
| SMILES | COC(=O)C(CCCCCCCCC1c2ccc(OC)cc2SCC1(C)c1ccc(OC)cc1)CCCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C37H51F5O4S/c1-35(28-18-20-29(44-2)21-19-28)26-47-33-25-30(45-3)22-23-31(33)32(35)17-13-8-6-5-7-11-15-27(34(43)46-4)16-12-9-10-14-24-36(38,39)37(40,41)42/h18-23,25,27,32H,5-17,24,26H2,1-4H3 |
| InChIKey | FSGMFANEXRVUJJ-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.87 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|