C11H5NNa2O5S2 — CID 18552939
disodium;2-oxo-1H-benzo[cd]indole-6,8-disulfinate (PubChem CID 18552939) has the molecular formula C11H5NNa2O5S2 and a molecular weight of 341.28 g/mol. Its IUPAC name is disodium;2-oxo-1H-benzo[cd]indole-6,8-disulfinate.
| Compound Name | disodium;2-oxo-1H-benzo[cd]indole-6,8-disulfinate |
|---|---|
| PubChem CID | 18552939 |
| Molecular Formula | C11H5NNa2O5S2 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | disodium;2-oxo-1H-benzo[cd]indole-6,8-disulfinate |
| SMILES | O=C1Nc2c(S(=O)[O-])cc(S(=O)[O-])c3cccc1c23.[Na+].[Na+] |
| InChI | InChI=1S/C11H7NO5S2.2Na/c13-11-6-3-1-2-5-7(18(14)15)4-8(19(16)17)10(12-11)9(5)6;;/h1-4H,(H,12,13)(H,14,15)(H,16,17);;/q;2*+1/p-2 |
| InChIKey | GBKZVDVNFHGPEJ-UHFFFAOYSA-L |
| XLogP | -5.11 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | -5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|