C21H21N3O4 — CID 18555446
2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(5-methoxyquinolin-8-yl)acetamide (PubChem CID 18555446) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(5-methoxyquinolin-8-yl)acetamide.
| Compound Name | 2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(5-methoxyquinolin-8-yl)acetamide |
|---|---|
| PubChem CID | 18555446 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(5-methoxyquinolin-8-yl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)[C@@H]3[C@H]4CC[C@@H](C4)[C@@H]3C2=O)c2ncccc12 |
| InChI | InChI=1S/C21H21N3O4/c1-28-15-7-6-14(19-13(15)3-2-8-22-19)23-16(25)10-24-20(26)17-11-4-5-12(9-11)18(17)21(24)27/h2-3,6-8,11-12,17-18H,4-5,9-10H2,1H3,(H,23,25)/t11-,12-,17-,18+/m0/s1 |
| InChIKey | VWTLHFPNKAAERG-GNTOHDJUSA-N |
| XLogP | 2.21 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|