C21H24N4O7S — CID 18562471
N-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]-N'-(pyridin-4-ylmethyl)oxamide (PubChem CID 18562471) has the molecular formula C21H24N4O7S and a molecular weight of 476.51 g/mol. Its IUPAC name is N-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]-N'-(pyridin-4-ylmethyl)oxamide.
| Compound Name | N-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]-N'-(pyridin-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 18562471 |
| Molecular Formula | C21H24N4O7S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]-N'-(pyridin-4-ylmethyl)oxamide |
| SMILES | O=C(NCc1ccncc1)C(=O)NCC1OCCCN1S(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H24N4O7S/c26-20(23-13-15-4-6-22-7-5-15)21(27)24-14-19-25(8-1-9-32-19)33(28,29)16-2-3-17-18(12-16)31-11-10-30-17/h2-7,12,19H,1,8-11,13-14H2,(H,23,26)(H,24,27) |
| InChIKey | QCYBCBUQBKGRSG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|