C20H27N3O7S — CID 42427999
N'-cyclopentyl-N-[[(2S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]oxamide (PubChem CID 42427999) has the molecular formula C20H27N3O7S and a molecular weight of 453.52 g/mol. Its IUPAC name is N'-cyclopentyl-N-[[(2S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]oxamide.
| Compound Name | N'-cyclopentyl-N-[[(2S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 42427999 |
| Molecular Formula | C20H27N3O7S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N'-cyclopentyl-N-[[(2S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-oxazinan-2-yl]methyl]oxamide |
| SMILES | O=C(NC[C@@H]1OCCCN1S(=O)(=O)c1ccc2c(c1)OCCO2)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H27N3O7S/c24-19(20(25)22-14-4-1-2-5-14)21-13-18-23(8-3-9-30-18)31(26,27)15-6-7-16-17(12-15)29-11-10-28-16/h6-7,12,14,18H,1-5,8-11,13H2,(H,21,24)(H,22,25)/t18-/m0/s1 |
| InChIKey | YDQABDBGKVSRJV-SFHVURJKSA-N |
| XLogP | 0.37 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|