C25H28N4O5S — CID 18563679
4-[[2-[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]sulfonylacetyl]amino]benzamide (PubChem CID 18563679) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-[[2-[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]sulfonylacetyl]amino]benzamide.
| Compound Name | 4-[[2-[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]sulfonylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 18563679 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4-[[2-[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]sulfonylacetyl]amino]benzamide |
| SMILES | CC1CCN(C(=O)Cn2cc(S(=O)(=O)CC(=O)Nc3ccc(C(N)=O)cc3)c3ccccc32)CC1 |
| InChI | InChI=1S/C25H28N4O5S/c1-17-10-12-28(13-11-17)24(31)15-29-14-22(20-4-2-3-5-21(20)29)35(33,34)16-23(30)27-19-8-6-18(7-9-19)25(26)32/h2-9,14,17H,10-13,15-16H2,1H3,(H2,26,32)(H,27,30) |
| InChIKey | UGKHLKAJWVUJNI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |