C22H22ClN3O3S — CID 18563721
N-[2-(dimethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide;hydrochloride (PubChem CID 18563721) has the molecular formula C22H22ClN3O3S and a molecular weight of 443.96 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18563721 |
| Molecular Formula | C22H22ClN3O3S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide;hydrochloride |
| SMILES | Cc1ccc2nc(N(CCN(C)C)C(=O)c3cc4ccccc4oc3=O)sc2c1.Cl |
| InChI | InChI=1S/C22H21N3O3S.ClH/c1-14-8-9-17-19(12-14)29-22(23-17)25(11-10-24(2)3)20(26)16-13-15-6-4-5-7-18(15)28-21(16)27;/h4-9,12-13H,10-11H2,1-3H3;1H |
| InChIKey | QXPCISSZUKVNSO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|