C27H26ClN3O3S — CID 44928682
N-[2-(dimethylamino)ethyl]-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride (PubChem CID 44928682) has the molecular formula C27H26ClN3O3S and a molecular weight of 508.04 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 44928682 |
| Molecular Formula | C27H26ClN3O3S |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride |
| SMILES | Cc1cc2nc(N(CCN(C)C)C(=O)c3cc4c(ccc5ccccc54)oc3=O)sc2cc1C.Cl |
| InChI | InChI=1S/C27H25N3O3S.ClH/c1-16-13-22-24(14-17(16)2)34-27(28-22)30(12-11-29(3)4)25(31)21-15-20-19-8-6-5-7-18(19)9-10-23(20)33-26(21)32;/h5-10,13-15H,11-12H2,1-4H3;1H |
| InChIKey | ZQHOUQYOIOHLMK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|