C28H26ClN3O5S — CID 44930713
N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride (PubChem CID 44930713) has the molecular formula C28H26ClN3O5S and a molecular weight of 552.05 g/mol. Its IUPAC name is N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride.
| Compound Name | N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 44930713 |
| Molecular Formula | C28H26ClN3O5S |
| Molecular Weight | 552.05 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride |
| SMILES | CN(C)CCCN(C(=O)c1cc2c(ccc3ccccc32)oc1=O)c1nc2cc3c(cc2s1)OCCO3.Cl |
| InChI | InChI=1S/C28H25N3O5S.ClH/c1-30(2)10-5-11-31(28-29-21-15-23-24(16-25(21)37-28)35-13-12-34-23)26(32)20-14-19-18-7-4-3-6-17(18)8-9-22(19)36-27(20)33;/h3-4,6-9,14-16H,5,10-13H2,1-2H3;1H |
| InChIKey | XKSPSKYPACJDME-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 85.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.05 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|