C27H26ClN3O4S — CID 44924729
N-[2-(dimethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride (PubChem CID 44924729) has the molecular formula C27H26ClN3O4S and a molecular weight of 524.04 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 44924729 |
| Molecular Formula | C27H26ClN3O4S |
| Molecular Weight | 524.04 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride |
| SMILES | COc1ccc(C)c2sc(N(CCN(C)C)C(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12.Cl |
| InChI | InChI=1S/C27H25N3O4S.ClH/c1-16-9-11-22(33-4)23-24(16)35-27(28-23)30(14-13-29(2)3)25(31)20-15-19-18-8-6-5-7-17(18)10-12-21(19)34-26(20)32;/h5-12,15H,13-14H2,1-4H3;1H |
| InChIKey | ZDRJURMKUFDAML-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.04 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|