C29H21N3O5S — CID 43966427
N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-oxo-N-(pyridin-3-ylmethyl)benzo[f]chromene-2-carboxamide (PubChem CID 43966427) has the molecular formula C29H21N3O5S and a molecular weight of 523.57 g/mol. Its IUPAC name is N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-oxo-N-(pyridin-3-ylmethyl)benzo[f]chromene-2-carboxamide.
| Compound Name | N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-oxo-N-(pyridin-3-ylmethyl)benzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 43966427 |
| Molecular Formula | C29H21N3O5S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-oxo-N-(pyridin-3-ylmethyl)benzo[f]chromene-2-carboxamide |
| SMILES | COc1ccc(OC)c2sc(N(Cc3cccnc3)C(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 |
| InChI | InChI=1S/C29H21N3O5S/c1-35-23-11-12-24(36-2)26-25(23)31-29(38-26)32(16-17-6-5-13-30-15-17)27(33)21-14-20-19-8-4-3-7-18(19)9-10-22(20)37-28(21)34/h3-15H,16H2,1-2H3 |
| InChIKey | HUDPYSJNTJEKOG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|