C28H27N3O4S — CID 41348487
N-[3-(dimethylamino)propyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 41348487) has the molecular formula C28H27N3O4S and a molecular weight of 501.61 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 41348487 |
| Molecular Formula | C28H27N3O4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | COc1ccc(C)c2sc(N(CCCN(C)C)C(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 |
| InChI | InChI=1S/C28H27N3O4S/c1-17-10-12-23(34-4)24-25(17)36-28(29-24)31(15-7-14-30(2)3)26(32)21-16-20-19-9-6-5-8-18(19)11-13-22(20)35-27(21)33/h5-6,8-13,16H,7,14-15H2,1-4H3 |
| InChIKey | WANTYBNEKSHQTI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|