C25H21Cl2N3O3S — CID 44923968
N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride (PubChem CID 44923968) has the molecular formula C25H21Cl2N3O3S and a molecular weight of 514.43 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 44923968 |
| Molecular Formula | C25H21Cl2N3O3S |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride |
| SMILES | CN(C)CCN(C(=O)c1cc2c(ccc3ccccc32)oc1=O)c1nc2c(Cl)cccc2s1.Cl |
| InChI | InChI=1S/C25H20ClN3O3S.ClH/c1-28(2)12-13-29(25-27-22-19(26)8-5-9-21(22)33-25)23(30)18-14-17-16-7-4-3-6-15(16)10-11-20(17)32-24(18)31;/h3-11,14H,12-13H2,1-2H3;1H |
| InChIKey | NKBFWDBXCPPOKU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|