C27H25ClFN3O3S — CID 44926149
N-[2-(diethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride (PubChem CID 44926149) has the molecular formula C27H25ClFN3O3S and a molecular weight of 526.03 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 44926149 |
| Molecular Formula | C27H25ClFN3O3S |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide;hydrochloride |
| SMILES | CCN(CC)CCN(C(=O)c1cc2c(ccc3ccccc32)oc1=O)c1nc2c(F)cccc2s1.Cl |
| InChI | InChI=1S/C27H24FN3O3S.ClH/c1-3-30(4-2)14-15-31(27-29-24-21(28)10-7-11-23(24)35-27)25(32)20-16-19-18-9-6-5-8-17(18)12-13-22(19)34-26(20)33;/h5-13,16H,3-4,14-15H2,1-2H3;1H |
| InChIKey | BDUSASRLEAXNNL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|