C29H21N3O3S — CID 41055393
N-(4-ethyl-1,3-benzothiazol-2-yl)-3-oxo-N-(pyridin-2-ylmethyl)benzo[f]chromene-2-carboxamide (PubChem CID 41055393) has the molecular formula C29H21N3O3S and a molecular weight of 491.57 g/mol. Its IUPAC name is N-(4-ethyl-1,3-benzothiazol-2-yl)-3-oxo-N-(pyridin-2-ylmethyl)benzo[f]chromene-2-carboxamide.
| Compound Name | N-(4-ethyl-1,3-benzothiazol-2-yl)-3-oxo-N-(pyridin-2-ylmethyl)benzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 41055393 |
| Molecular Formula | C29H21N3O3S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-(4-ethyl-1,3-benzothiazol-2-yl)-3-oxo-N-(pyridin-2-ylmethyl)benzo[f]chromene-2-carboxamide |
| SMILES | CCc1cccc2sc(N(Cc3ccccn3)C(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 |
| InChI | InChI=1S/C29H21N3O3S/c1-2-18-9-7-12-25-26(18)31-29(36-25)32(17-20-10-5-6-15-30-20)27(33)23-16-22-21-11-4-3-8-19(21)13-14-24(22)35-28(23)34/h3-16H,2,17H2,1H3 |
| InChIKey | GVGMTQJZYCNRBQ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|