About N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide
N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide (PubChem CID 18565767) has the molecular formula C14H11F2N5OS
and a molecular weight of 335.34 g/mol. Its IUPAC name is N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide.
Molecular Properties
| Compound Name | N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide |
| PubChem CID | 18565767 |
| Molecular Formula | C14H11F2N5OS |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NCc1nnnn1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11F2N5OS/c15-11-4-3-9(6-12(11)16)21-13(18-19-20-21)8-17-14(22)7-10-2-1-5-23-10/h1-6H,7-8H2,(H,17,22) |
| InChIKey | QSLRWVBKDVQJMB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide?
The IUPAC name of N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide (CID 18565767) is N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide.
What is the SMILES notation for N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide?
The canonical SMILES for N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide is O=C(Cc1cccs1)NCc1nnnn1-c1ccc(F)c(F)c1.
What is the InChIKey of N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide?
The InChIKey is QSLRWVBKDVQJMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2N5OS/c15-11-4-3-9(6-12(11)16)21-13(18-19-20-21)8-17-14(22)7-10-2-1-5-23-10/h1-6H,7-8H2,(H,17,22).
What are the key properties of N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide?
N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide has a molecular weight of 335.34 g/mol, XLogP of 1.86, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]-2-thiophen-2-ylacetamide is sourced from PubChem (CID 18565767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).