C14H13FN6OS — CID 18566033
1-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 18566033) has the molecular formula C14H13FN6OS and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 18566033 |
| Molecular Formula | C14H13FN6OS |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-[[1-(3-fluorophenyl)tetrazol-5-yl]methyl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | O=C(NCc1cccs1)NCc1nnnn1-c1cccc(F)c1 |
| InChI | InChI=1S/C14H13FN6OS/c15-10-3-1-4-11(7-10)21-13(18-19-20-21)9-17-14(22)16-8-12-5-2-6-23-12/h1-7H,8-9H2,(H2,16,17,22) |
| InChIKey | AMIVCIWIZCUBQF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |