C19H22N6O2 — CID 18565961
1-(3,4-dimethylphenyl)-3-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]urea (PubChem CID 18565961) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 18565961 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]urea |
| SMILES | CCOc1ccc(-n2nnnc2CNC(=O)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C19H22N6O2/c1-4-27-17-9-7-16(8-10-17)25-18(22-23-24-25)12-20-19(26)21-15-6-5-13(2)14(3)11-15/h5-11H,4,12H2,1-3H3,(H2,20,21,26) |
| InChIKey | SLMOLPCDEQUVGA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |