C26H22FNO3 — CID 18568810
N-[2-(4-tert-butylphenyl)-4-oxochromen-6-yl]-2-fluorobenzamide (PubChem CID 18568810) has the molecular formula C26H22FNO3 and a molecular weight of 415.46 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-4-oxochromen-6-yl]-2-fluorobenzamide.
| Compound Name | N-[2-(4-tert-butylphenyl)-4-oxochromen-6-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 18568810 |
| Molecular Formula | C26H22FNO3 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-4-oxochromen-6-yl]-2-fluorobenzamide |
| SMILES | CC(C)(C)c1ccc(-c2cc(=O)c3cc(NC(=O)c4ccccc4F)ccc3o2)cc1 |
| InChI | InChI=1S/C26H22FNO3/c1-26(2,3)17-10-8-16(9-11-17)24-15-22(29)20-14-18(12-13-23(20)31-24)28-25(30)19-6-4-5-7-21(19)27/h4-15H,1-3H3,(H,28,30) |
| InChIKey | AZTBSTWTWIOZMD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |