C21H27FN4O4 — CID 18569589
2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 18569589) has the molecular formula C21H27FN4O4 and a molecular weight of 418.47 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18569589 |
| Molecular Formula | C21H27FN4O4 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(CN1CCC2(CC1)NC(=O)N(Cc1ccc(F)cc1)C2=O)NCC1CCCO1 |
| InChI | InChI=1S/C21H27FN4O4/c22-16-5-3-15(4-6-16)13-26-19(28)21(24-20(26)29)7-9-25(10-8-21)14-18(27)23-12-17-2-1-11-30-17/h3-6,17H,1-2,7-14H2,(H,23,27)(H,24,29) |
| InChIKey | JFVGJZSKUREJIY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|