C22H16FN3OS — CID 18572544
(E)-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-phenyl-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 18572544) has the molecular formula C22H16FN3OS and a molecular weight of 389.46 g/mol. Its IUPAC name is (E)-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-phenyl-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-phenyl-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 18572544 |
| Molecular Formula | C22H16FN3OS |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (E)-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-phenyl-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N(Cc1cccnc1)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C22H16FN3OS/c23-18-9-4-10-19-21(18)25-22(28-19)26(15-17-8-5-13-24-14-17)20(27)12-11-16-6-2-1-3-7-16/h1-14H,15H2/b12-11+ |
| InChIKey | KPFMCOXJGPGTEK-VAWYXSNFSA-N |
| XLogP | 5.08 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|