C24H20FN3O3S — CID 43967084
(E)-3-(3,4-dimethoxyphenyl)-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 43967084) has the molecular formula C24H20FN3O3S and a molecular weight of 449.51 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 43967084 |
| Molecular Formula | C24H20FN3O3S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(Cc2cccnc2)c2nc3c(F)cccc3s2)cc1OC |
| InChI | InChI=1S/C24H20FN3O3S/c1-30-19-10-8-16(13-20(19)31-2)9-11-22(29)28(15-17-5-4-12-26-14-17)24-27-23-18(25)6-3-7-21(23)32-24/h3-14H,15H2,1-2H3/b11-9+ |
| InChIKey | UVIYMGXUQNTKGK-PKNBQFBNSA-N |
| XLogP | 5.09 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|