C23H26FN3O3S — CID 43964771
(E)-3-(3,4-dimethoxyphenyl)-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 43964771) has the molecular formula C23H26FN3O3S and a molecular weight of 443.54 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 43964771 |
| Molecular Formula | C23H26FN3O3S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(CCCN(C)C)c2nc3c(F)cccc3s2)cc1OC |
| InChI | InChI=1S/C23H26FN3O3S/c1-26(2)13-6-14-27(23-25-22-17(24)7-5-8-20(22)31-23)21(28)12-10-16-9-11-18(29-3)19(15-16)30-4/h5,7-12,15H,6,13-14H2,1-4H3/b12-10+ |
| InChIKey | IBAUGEIYDLRGHB-ZRDIBKRKSA-N |
| XLogP | 4.45 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|