C24H28FN3O4S — CID 43964477
(E)-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 43964477) has the molecular formula C24H28FN3O4S and a molecular weight of 473.57 g/mol. Its IUPAC name is (E)-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 43964477 |
| Molecular Formula | C24H28FN3O4S |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (E)-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(CCCN(C)C)c2nc3c(F)cccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C24H28FN3O4S/c1-27(2)12-7-13-28(24-26-22-17(25)8-6-9-20(22)33-24)21(29)11-10-16-14-18(30-3)23(32-5)19(15-16)31-4/h6,8-11,14-15H,7,12-13H2,1-5H3/b11-10+ |
| InChIKey | YVDUWANCTFEGTQ-ZHACJKMWSA-N |
| XLogP | 4.46 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|