C26H21F3N2O3S — CID 121047400
(E)-N-benzyl-3-(3,4-dimethoxyphenyl)-N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enamide (PubChem CID 121047400) has the molecular formula C26H21F3N2O3S and a molecular weight of 498.53 g/mol. Its IUPAC name is (E)-N-benzyl-3-(3,4-dimethoxyphenyl)-N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-3-(3,4-dimethoxyphenyl)-N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 121047400 |
| Molecular Formula | C26H21F3N2O3S |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | (E)-N-benzyl-3-(3,4-dimethoxyphenyl)-N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(Cc2ccccc2)c2nc3c(C(F)(F)F)cccc3s2)cc1OC |
| InChI | InChI=1S/C26H21F3N2O3S/c1-33-20-13-11-17(15-21(20)34-2)12-14-23(32)31(16-18-7-4-3-5-8-18)25-30-24-19(26(27,28)29)9-6-10-22(24)35-25/h3-15H,16H2,1-2H3/b14-12+ |
| InChIKey | XOXNAMLQIRKEPT-WYMLVPIESA-N |
| XLogP | 6.58 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|