C20H20N4OS — CID 18582332
1-[2-(1H-indol-3-ylsulfanyl)ethyl]-3-(1-methylindol-3-yl)urea (PubChem CID 18582332) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-ylsulfanyl)ethyl]-3-(1-methylindol-3-yl)urea.
| Compound Name | 1-[2-(1H-indol-3-ylsulfanyl)ethyl]-3-(1-methylindol-3-yl)urea |
|---|---|
| PubChem CID | 18582332 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-[2-(1H-indol-3-ylsulfanyl)ethyl]-3-(1-methylindol-3-yl)urea |
| SMILES | Cn1cc(NC(=O)NCCSc2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C20H20N4OS/c1-24-13-17(14-6-3-5-9-18(14)24)23-20(25)21-10-11-26-19-12-22-16-8-4-2-7-15(16)19/h2-9,12-13,22H,10-11H2,1H3,(H2,21,23,25) |
| InChIKey | VNDIQZUHTWYUJO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|