C17H20N8OS — CID 18584286
1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]urea (PubChem CID 18584286) has the molecular formula C17H20N8OS and a molecular weight of 384.47 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]urea.
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]urea |
|---|---|
| PubChem CID | 18584286 |
| Molecular Formula | C17H20N8OS |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]urea |
| SMILES | Cc1cc(C)nc(NC(=O)NCCCSc2nnnn2-c2ccccc2)n1 |
| InChI | InChI=1S/C17H20N8OS/c1-12-11-13(2)20-15(19-12)21-16(26)18-9-6-10-27-17-22-23-24-25(17)14-7-4-3-5-8-14/h3-5,7-8,11H,6,9-10H2,1-2H3,(H2,18,19,20,21,26) |
| InChIKey | VIALIVKXEJMSRS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|