C21H17N5O2 — CID 18585029
1-[2-oxo-3-(pyridin-3-ylmethyl)quinazolin-4-yl]-3-phenylurea (PubChem CID 18585029) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 1-[2-oxo-3-(pyridin-3-ylmethyl)quinazolin-4-yl]-3-phenylurea.
| Compound Name | 1-[2-oxo-3-(pyridin-3-ylmethyl)quinazolin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 18585029 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-[2-oxo-3-(pyridin-3-ylmethyl)quinazolin-4-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1c2ccccc2nc(=O)n1Cc1cccnc1 |
| InChI | InChI=1S/C21H17N5O2/c27-20(23-16-8-2-1-3-9-16)25-19-17-10-4-5-11-18(17)24-21(28)26(19)14-15-7-6-12-22-13-15/h1-13H,14H2,(H2,23,25,27) |
| InChIKey | ZONHBAOVSSMILQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |