C15H13FN2O3S2 — CID 18586001
N-(3-cyanothiophen-2-yl)-4-(4-fluorophenyl)sulfonylbutanamide (PubChem CID 18586001) has the molecular formula C15H13FN2O3S2 and a molecular weight of 352.41 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-4-(4-fluorophenyl)sulfonylbutanamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-4-(4-fluorophenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 18586001 |
| Molecular Formula | C15H13FN2O3S2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-4-(4-fluorophenyl)sulfonylbutanamide |
| SMILES | N#Cc1ccsc1NC(=O)CCCS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H13FN2O3S2/c16-12-3-5-13(6-4-12)23(20,21)9-1-2-14(19)18-15-11(10-17)7-8-22-15/h3-8H,1-2,9H2,(H,18,19) |
| InChIKey | STGSWHSHIMQGEF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |