C15H15FN4O5S — CID 18586425
N'-[2-(4-fluorophenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-hydroxyethyl)oxamide (PubChem CID 18586425) has the molecular formula C15H15FN4O5S and a molecular weight of 382.37 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-hydroxyethyl)oxamide.
| Compound Name | N'-[2-(4-fluorophenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 18586425 |
| Molecular Formula | C15H15FN4O5S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N'-[2-(4-fluorophenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-hydroxyethyl)oxamide |
| SMILES | O=C(NCCO)C(=O)Nc1c2c(nn1-c1ccc(F)cc1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C15H15FN4O5S/c16-9-1-3-10(4-2-9)20-13(18-15(23)14(22)17-5-6-21)11-7-26(24,25)8-12(11)19-20/h1-4,21H,5-8H2,(H,17,22)(H,18,23) |
| InChIKey | WNGFIEKCNJJCAU-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|