C23H24N4O6S — CID 41325919
N'-[2-(4-methoxyphenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[2-(3-methoxyphenyl)ethyl]oxamide (PubChem CID 41325919) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is N'-[2-(4-methoxyphenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[2-(3-methoxyphenyl)ethyl]oxamide.
| Compound Name | N'-[2-(4-methoxyphenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[2-(3-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 41325919 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | N'-[2-(4-methoxyphenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[2-(3-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc(-n2nc3c(c2NC(=O)C(=O)NCCc2cccc(OC)c2)CS(=O)(=O)C3)cc1 |
| InChI | InChI=1S/C23H24N4O6S/c1-32-17-8-6-16(7-9-17)27-21(19-13-34(30,31)14-20(19)26-27)25-23(29)22(28)24-11-10-15-4-3-5-18(12-15)33-2/h3-9,12H,10-11,13-14H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | ZSOWYMBZTXXVHW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|