C21H19ClN4O4S — CID 41326248
N'-[2-(3-chlorophenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-phenylethyl)oxamide (PubChem CID 41326248) has the molecular formula C21H19ClN4O4S and a molecular weight of 458.93 g/mol. Its IUPAC name is N'-[2-(3-chlorophenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-phenylethyl)oxamide.
| Compound Name | N'-[2-(3-chlorophenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 41326248 |
| Molecular Formula | C21H19ClN4O4S |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | N'-[2-(3-chlorophenyl)-5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-phenylethyl)oxamide |
| SMILES | O=C(NCCc1ccccc1)C(=O)Nc1c2c(nn1-c1cccc(Cl)c1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C21H19ClN4O4S/c22-15-7-4-8-16(11-15)26-19(17-12-31(29,30)13-18(17)25-26)24-21(28)20(27)23-10-9-14-5-2-1-3-6-14/h1-8,11H,9-10,12-13H2,(H,23,27)(H,24,28) |
| InChIKey | BXBJQYYCMATRQU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|