C18H20N6O6 — CID 18586657
N-(1-tert-butyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 18586657) has the molecular formula C18H20N6O6 and a molecular weight of 416.39 g/mol. Its IUPAC name is N-(1-tert-butyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-(1-tert-butyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 18586657 |
| Molecular Formula | C18H20N6O6 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-(1-tert-butyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nn2cnc3c(cnn3C(C)(C)C)c2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H20N6O6/c1-18(2,3)23-15-11(8-20-23)17(26)22(9-19-15)21-16(25)10-6-13(29-4)14(30-5)7-12(10)24(27)28/h6-9H,1-5H3,(H,21,25) |
| InChIKey | AHVPYQIMSUGNMD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 143.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|