C20H19N3O3S2 — CID 18591479
4-[[3-(3-methylsulfanylphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]methyl]benzonitrile (PubChem CID 18591479) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-[[3-(3-methylsulfanylphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[3-(3-methylsulfanylphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 18591479 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 4-[[3-(3-methylsulfanylphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]methyl]benzonitrile |
| SMILES | CSc1cccc(N2C(=O)N(Cc3ccc(C#N)cc3)C3CS(=O)(=O)CC32)c1 |
| InChI | InChI=1S/C20H19N3O3S2/c1-27-17-4-2-3-16(9-17)23-19-13-28(25,26)12-18(19)22(20(23)24)11-15-7-5-14(10-21)6-8-15/h2-9,18-19H,11-13H2,1H3 |
| InChIKey | RPEUDEAISBMSBL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|