C10H10N2O3S — CID 18592800
4-methyl-2-oxo-1H-quinoline-6-sulfonamide (PubChem CID 18592800) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 4-methyl-2-oxo-1H-quinoline-6-sulfonamide.
| Compound Name | 4-methyl-2-oxo-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 18592800 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4-methyl-2-oxo-1H-quinoline-6-sulfonamide |
| SMILES | Cc1cc(=O)[nH]c2ccc(S(N)(=O)=O)cc12 |
| InChI | InChI=1S/C10H10N2O3S/c1-6-4-10(13)12-9-3-2-7(5-8(6)9)16(11,14)15/h2-5H,1H3,(H,12,13)(H2,11,14,15) |
| InChIKey | SIQRLMUTGXSGAJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |