C21H23N3O7S — CID 18594490
(2,5-dioxopyrrolidin-1-yl)methyl (6S)-7-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 18594490) has the molecular formula C21H23N3O7S and a molecular weight of 461.50 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl)methyl (6S)-7-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl)methyl (6S)-7-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 18594490 |
| Molecular Formula | C21H23N3O7S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl)methyl (6S)-7-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OCN2C(=O)CCC2=O)N2C(=O)C(N3C(=O)C4CCCCC4C3=O)[C@@H]2SC1 |
| InChI | InChI=1S/C21H23N3O7S/c1-10-8-32-20-16(23-17(27)11-4-2-3-5-12(11)18(23)28)19(29)24(20)15(10)21(30)31-9-22-13(25)6-7-14(22)26/h11-12,16,20H,2-9H2,1H3/t11?,12?,16?,20-/m0/s1 |
| InChIKey | ZFPJCIVZGTYOOO-JABKHKSQSA-N |
| XLogP | 0.37 |
| TPSA | 121.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|