C11H18N2O3SSi — CID 10891470
trimethylsilyl (6R,7R)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 10891470) has the molecular formula C11H18N2O3SSi and a molecular weight of 286.43 g/mol. Its IUPAC name is trimethylsilyl (6R,7R)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | trimethylsilyl (6R,7R)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10891470 |
| Molecular Formula | C11H18N2O3SSi |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | trimethylsilyl (6R,7R)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)O[Si](C)(C)C)N2C(=O)[C@@H](N)[C@H]2SC1 |
| InChI | InChI=1S/C11H18N2O3SSi/c1-6-5-17-10-7(12)9(14)13(10)8(6)11(15)16-18(2,3)4/h7,10H,5,12H2,1-4H3/t7-,10-/m1/s1 |
| InChIKey | JQIQXYCEWMLAJC-GMSGAONNSA-N |
| XLogP | 0.88 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|