C7H11N2O4PS — CID 70636373
[(6S,7S)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl]phosphonic acid (PubChem CID 70636373) has the molecular formula C7H11N2O4PS and a molecular weight of 250.22 g/mol. Its IUPAC name is [(6S,7S)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl]phosphonic acid.
| Compound Name | [(6S,7S)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 70636373 |
| Molecular Formula | C7H11N2O4PS |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | [(6S,7S)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl]phosphonic acid |
| SMILES | CC1=C(P(=O)(O)O)N2C(=O)[C@H](N)[C@@H]2SC1 |
| InChI | InChI=1S/C7H11N2O4PS/c1-3-2-15-7-4(8)5(10)9(7)6(3)14(11,12)13/h4,7H,2,8H2,1H3,(H2,11,12,13)/t4-,7-/m0/s1 |
| InChIKey | QCFCMQMLXAJGQJ-FFWSUHOLSA-N |
| XLogP | -0.36 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|