C9H13N2O6PS — CID 22798295
[(6S,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl]phosphonic acid (PubChem CID 22798295) has the molecular formula C9H13N2O6PS and a molecular weight of 308.25 g/mol. Its IUPAC name is [(6S,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl]phosphonic acid.
| Compound Name | [(6S,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 22798295 |
| Molecular Formula | C9H13N2O6PS |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | [(6S,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl]phosphonic acid |
| SMILES | CC(=O)OCC1=C(P(=O)(O)O)N2C(=O)[C@@H](N)[C@@H]2SC1 |
| InChI | InChI=1S/C9H13N2O6PS/c1-4(12)17-2-5-3-19-9-6(10)7(13)11(9)8(5)18(14,15)16/h6,9H,2-3,10H2,1H3,(H2,14,15,16)/t6-,9+/m1/s1 |
| InChIKey | NXSXUFWDWZARQN-MUWHJKNJSA-N |
| XLogP | -0.82 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|