C13H19N5O3S3Si — CID 20758028
trimethylsilyl (6S)-7-amino-8-oxo-3-(2H-triazol-4-ylsulfanylmethylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 20758028) has the molecular formula C13H19N5O3S3Si and a molecular weight of 417.61 g/mol. Its IUPAC name is trimethylsilyl (6S)-7-amino-8-oxo-3-(2H-triazol-4-ylsulfanylmethylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | trimethylsilyl (6S)-7-amino-8-oxo-3-(2H-triazol-4-ylsulfanylmethylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 20758028 |
| Molecular Formula | C13H19N5O3S3Si |
| Molecular Weight | 417.61 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | trimethylsilyl (6S)-7-amino-8-oxo-3-(2H-triazol-4-ylsulfanylmethylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1=C(SCSc2cn[nH]n2)CS[C@H]2C(N)C(=O)N12 |
| InChI | InChI=1S/C13H19N5O3S3Si/c1-25(2,3)21-13(20)10-7(23-6-24-8-4-15-17-16-8)5-22-12-9(14)11(19)18(10)12/h4,9,12H,5-6,14H2,1-3H3,(H,15,16,17)/t9?,12-/m0/s1 |
| InChIKey | XBFCYUNUDLOPDT-ACGXKRRESA-N |
| XLogP | 1.42 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.61 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|