C11H15N3O4S2 — CID 56629738
(6S,7R)-3-(2-acetamidoethylsulfanyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 56629738) has the molecular formula C11H15N3O4S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (6S,7R)-3-(2-acetamidoethylsulfanyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-3-(2-acetamidoethylsulfanyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56629738 |
| Molecular Formula | C11H15N3O4S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | (6S,7R)-3-(2-acetamidoethylsulfanyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)NCCSC1=C(C(=O)O)N2C(=O)[C@@H](N)[C@@H]2SC1 |
| InChI | InChI=1S/C11H15N3O4S2/c1-5(15)13-2-3-19-6-4-20-10-7(12)9(16)14(10)8(6)11(17)18/h7,10H,2-4,12H2,1H3,(H,13,15)(H,17,18)/t7-,10+/m1/s1 |
| InChIKey | LBKQRHFWMWEGFH-XCBNKYQSSA-N |
| XLogP | -0.61 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|