C9H10N2O6S — CID 88729546
(6R,7R)-3-acetylperoxy-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88729546) has the molecular formula C9H10N2O6S and a molecular weight of 274.25 g/mol. Its IUPAC name is (6R,7R)-3-acetylperoxy-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-acetylperoxy-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88729546 |
| Molecular Formula | C9H10N2O6S |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | (6R,7R)-3-acetylperoxy-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OOC1=C(C(=O)O)N2C(=O)[C@@H](N)[C@H]2SC1 |
| InChI | InChI=1S/C9H10N2O6S/c1-3(12)16-17-4-2-18-8-5(10)7(13)11(8)6(4)9(14)15/h5,8H,2,10H2,1H3,(H,14,15)/t5-,8-/m1/s1 |
| InChIKey | JXKYMBVCOBWXSY-SVGQVSJJSA-N |
| XLogP | -0.98 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|