C18H18O2S — CID 18597523
(6R)-6-[phenyl(phenylsulfanyl)methyl]oxan-2-one (PubChem CID 18597523) has the molecular formula C18H18O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is (6R)-6-[phenyl(phenylsulfanyl)methyl]oxan-2-one.
| Compound Name | (6R)-6-[phenyl(phenylsulfanyl)methyl]oxan-2-one |
|---|---|
| PubChem CID | 18597523 |
| Molecular Formula | C18H18O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (6R)-6-[phenyl(phenylsulfanyl)methyl]oxan-2-one |
| SMILES | O=C1CCC[C@H](C(Sc2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C18H18O2S/c19-17-13-7-12-16(20-17)18(14-8-3-1-4-9-14)21-15-10-5-2-6-11-15/h1-6,8-11,16,18H,7,12-13H2/t16-,18?/m1/s1 |
| InChIKey | WEILNLJYCQXOID-PYUWXLGESA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |