C19H24O2S — CID 92983342
2-[(R)-cyclohexyl(phenylsulfanyl)methyl]-3-hydroxycyclohex-2-en-1-one (PubChem CID 92983342) has the molecular formula C19H24O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is 2-[(R)-cyclohexyl(phenylsulfanyl)methyl]-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-[(R)-cyclohexyl(phenylsulfanyl)methyl]-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 92983342 |
| Molecular Formula | C19H24O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-[(R)-cyclohexyl(phenylsulfanyl)methyl]-3-hydroxycyclohex-2-en-1-one |
| SMILES | O=C1CCCC(O)=C1[C@H](Sc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H24O2S/c20-16-12-7-13-17(21)18(16)19(14-8-3-1-4-9-14)22-15-10-5-2-6-11-15/h2,5-6,10-11,14,19-20H,1,3-4,7-9,12-13H2/t19-/m1/s1 |
| InChIKey | JLGZYHZHMKGONM-LJQANCHMSA-N |
| XLogP | 5.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |