C15H18O2S — CID 151243399
3-hydroxy-2-(2-phenylsulfanylpropyl)cyclohex-2-en-1-one (PubChem CID 151243399) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 3-hydroxy-2-(2-phenylsulfanylpropyl)cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-2-(2-phenylsulfanylpropyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 151243399 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-hydroxy-2-(2-phenylsulfanylpropyl)cyclohex-2-en-1-one |
| SMILES | CC(CC1=C(O)CCCC1=O)Sc1ccccc1 |
| InChI | InChI=1S/C15H18O2S/c1-11(18-12-6-3-2-4-7-12)10-13-14(16)8-5-9-15(13)17/h2-4,6-7,11,16H,5,8-10H2,1H3 |
| InChIKey | NQUFBSGAMKAQSV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |