C29H26O2S — CID 98167724
3-hydroxy-2-[(R)-phenylsulfanyl-[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]cyclohex-2-en-1-one (PubChem CID 98167724) has the molecular formula C29H26O2S and a molecular weight of 438.59 g/mol. Its IUPAC name is 3-hydroxy-2-[(R)-phenylsulfanyl-[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-2-[(R)-phenylsulfanyl-[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 98167724 |
| Molecular Formula | C29H26O2S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-hydroxy-2-[(R)-phenylsulfanyl-[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]cyclohex-2-en-1-one |
| SMILES | O=C1CCCC(O)=C1[C@H](Sc1ccccc1)[C@@H]1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C29H26O2S/c30-25-15-8-16-26(31)28(25)29(32-18-9-2-1-3-10-18)24-17-23-19-11-4-6-13-21(19)27(24)22-14-7-5-12-20(22)23/h1-7,9-14,23-24,27,29-30H,8,15-17H2/t23?,24-,27?,29-/m1/s1 |
| InChIKey | UXFUODISDMCESE-WNDOJPOZSA-N |
| XLogP | 7.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |