C19H19BrO4 — CID 154732323
2-[(2-bromophenyl)-(2-hydroxy-6-oxocyclohexen-1-yl)methyl]-3-hydroxycyclohex-2-en-1-one (PubChem CID 154732323) has the molecular formula C19H19BrO4 and a molecular weight of 391.26 g/mol. Its IUPAC name is 2-[(2-bromophenyl)-(2-hydroxy-6-oxocyclohexen-1-yl)methyl]-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-[(2-bromophenyl)-(2-hydroxy-6-oxocyclohexen-1-yl)methyl]-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 154732323 |
| Molecular Formula | C19H19BrO4 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 2-[(2-bromophenyl)-(2-hydroxy-6-oxocyclohexen-1-yl)methyl]-3-hydroxycyclohex-2-en-1-one |
| SMILES | O=C1CCCC(O)=C1C(C1=C(O)CCCC1=O)c1ccccc1Br |
| InChI | InChI=1S/C19H19BrO4/c20-12-6-2-1-5-11(12)17(18-13(21)7-3-8-14(18)22)19-15(23)9-4-10-16(19)24/h1-2,5-6,17,21,23H,3-4,7-10H2 |
| InChIKey | GWJRDZQCHBCPBU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |