C18H19NO4 — CID 101009543
3-hydroxy-2-[(2-hydroxy-6-oxocyclohexen-1-yl)-pyridin-2-ylmethyl]cyclohex-2-en-1-one (PubChem CID 101009543) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-hydroxy-2-[(2-hydroxy-6-oxocyclohexen-1-yl)-pyridin-2-ylmethyl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-2-[(2-hydroxy-6-oxocyclohexen-1-yl)-pyridin-2-ylmethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 101009543 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-hydroxy-2-[(2-hydroxy-6-oxocyclohexen-1-yl)-pyridin-2-ylmethyl]cyclohex-2-en-1-one |
| SMILES | O=C1CCCC(O)=C1C(C1=C(O)CCCC1=O)c1ccccn1 |
| InChI | InChI=1S/C18H19NO4/c20-12-6-3-7-13(21)17(12)16(11-5-1-2-10-19-11)18-14(22)8-4-9-15(18)23/h1-2,5,10,16,20,22H,3-4,6-9H2 |
| InChIKey | OKZVDPCAJSATEY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |