C20H20OS2 — CID 92525593
methyl (3R)-3-hydroxy-3-[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]propanedithioate (PubChem CID 92525593) has the molecular formula C20H20OS2 and a molecular weight of 340.51 g/mol. Its IUPAC name is methyl (3R)-3-hydroxy-3-[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]propanedithioate.
| Compound Name | methyl (3R)-3-hydroxy-3-[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]propanedithioate |
|---|---|
| PubChem CID | 92525593 |
| Molecular Formula | C20H20OS2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | methyl (3R)-3-hydroxy-3-[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]propanedithioate |
| SMILES | CSC(=S)C[C@@H](O)[C@H]1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C20H20OS2/c1-23-19(22)11-18(21)17-10-16-12-6-2-4-8-14(12)20(17)15-9-5-3-7-13(15)16/h2-9,16-18,20-21H,10-11H2,1H3/t16?,17-,18-,20?/m1/s1 |
| InChIKey | HBXQKYHUVCXNNU-SFANZJOMSA-N |
| XLogP | 4.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|